C23H17ClN2O2S — CID 6384196
(2E)-2-[(4-chlorophenyl)methylidene]-5-phenyl-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione (PubChem CID 6384196) has the molecular formula C23H17ClN2O2S and a molecular weight of 420.92 g/mol. Its IUPAC name is (2E)-2-[(4-chlorophenyl)methylidene]-5-phenyl-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione.
| Compound Name | (2E)-2-[(4-chlorophenyl)methylidene]-5-phenyl-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
|---|---|
| PubChem CID | 6384196 |
| Molecular Formula | C23H17ClN2O2S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | (2E)-2-[(4-chlorophenyl)methylidene]-5-phenyl-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
| SMILES | O=C1CCCC2=C1C(c1ccccc1)n1c(s/c(=C/c3ccc(Cl)cc3)c1=O)=N2 |
| InChI | InChI=1S/C23H17ClN2O2S/c24-16-11-9-14(10-12-16)13-19-22(28)26-21(15-5-2-1-3-6-15)20-17(25-23(26)29-19)7-4-8-18(20)27/h1-3,5-6,9-13,21H,4,7-8H2/b19-13+ |
| InChIKey | AEEVEFPJSUOOJK-CPNJWEJPSA-N |
| XLogP | 3.62 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |