C26H19N3O2S — CID 23804675
5-phenyl-2-(quinolin-6-ylmethylidene)-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione (PubChem CID 23804675) has the molecular formula C26H19N3O2S and a molecular weight of 437.52 g/mol. Its IUPAC name is 5-phenyl-2-(quinolin-6-ylmethylidene)-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione.
| Compound Name | 5-phenyl-2-(quinolin-6-ylmethylidene)-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
|---|---|
| PubChem CID | 23804675 |
| Molecular Formula | C26H19N3O2S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 5-phenyl-2-(quinolin-6-ylmethylidene)-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
| SMILES | O=C1CCCC2=C1C(c1ccccc1)n1c(sc(=Cc3ccc4ncccc4c3)c1=O)=N2 |
| InChI | InChI=1S/C26H19N3O2S/c30-21-10-4-9-20-23(21)24(17-6-2-1-3-7-17)29-25(31)22(32-26(29)28-20)15-16-11-12-19-18(14-16)8-5-13-27-19/h1-3,5-8,11-15,24H,4,9-10H2 |
| InChIKey | KGFAVLVFGVTUOX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |