C24H19N3O5S — CID 23962117
5-(4-methoxyphenyl)-2-[(3-nitrophenyl)methylidene]-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione (PubChem CID 23962117) has the molecular formula C24H19N3O5S and a molecular weight of 461.50 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2-[(3-nitrophenyl)methylidene]-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione.
| Compound Name | 5-(4-methoxyphenyl)-2-[(3-nitrophenyl)methylidene]-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
|---|---|
| PubChem CID | 23962117 |
| Molecular Formula | C24H19N3O5S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 5-(4-methoxyphenyl)-2-[(3-nitrophenyl)methylidene]-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
| SMILES | COc1ccc(C2C3=C(CCCC3=O)N=c3sc(=Cc4cccc([N+](=O)[O-])c4)c(=O)n32)cc1 |
| InChI | InChI=1S/C24H19N3O5S/c1-32-17-10-8-15(9-11-17)22-21-18(6-3-7-19(21)28)25-24-26(22)23(29)20(33-24)13-14-4-2-5-16(12-14)27(30)31/h2,4-5,8-13,22H,3,6-7H2,1H3 |
| InChIKey | RCYPTJQZHLJSCU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|