C32H27N3O5S — CID 129438931
(5R,9E)-5-(4-methoxyphenyl)-9-[(4-methoxyphenyl)methylidene]-2-[(3-nitrophenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one (PubChem CID 129438931) has the molecular formula C32H27N3O5S and a molecular weight of 565.65 g/mol. Its IUPAC name is (5R,9E)-5-(4-methoxyphenyl)-9-[(4-methoxyphenyl)methylidene]-2-[(3-nitrophenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one.
| Compound Name | (5R,9E)-5-(4-methoxyphenyl)-9-[(4-methoxyphenyl)methylidene]-2-[(3-nitrophenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one |
|---|---|
| PubChem CID | 129438931 |
| Molecular Formula | C32H27N3O5S |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | (5R,9E)-5-(4-methoxyphenyl)-9-[(4-methoxyphenyl)methylidene]-2-[(3-nitrophenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one |
| SMILES | COc1ccc(/C=C2\CCCC3=C2N=c2sc(=Cc4cccc([N+](=O)[O-])c4)c(=O)n2[C@@H]3c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H27N3O5S/c1-39-25-13-9-20(10-14-25)17-23-6-4-8-27-29(23)33-32-34(30(27)22-11-15-26(40-2)16-12-22)31(36)28(41-32)19-21-5-3-7-24(18-21)35(37)38/h3,5,7,9-19,30H,4,6,8H2,1-2H3/b23-17+,28-19?/t30-/m1/s1 |
| InChIKey | JJCOIPWPCWJDCS-MQPXPXQXSA-N |
| XLogP | 5.41 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|