C34H33N5O3S — CID 6899727
(2E,5R,9E)-5-[4-(dimethylamino)phenyl]-9-[[4-(dimethylamino)phenyl]methylidene]-2-[(2-nitrophenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one (PubChem CID 6899727) has the molecular formula C34H33N5O3S and a molecular weight of 591.74 g/mol. Its IUPAC name is (2E,5R,9E)-5-[4-(dimethylamino)phenyl]-9-[[4-(dimethylamino)phenyl]methylidene]-2-[(2-nitrophenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one.
| Compound Name | (2E,5R,9E)-5-[4-(dimethylamino)phenyl]-9-[[4-(dimethylamino)phenyl]methylidene]-2-[(2-nitrophenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one |
|---|---|
| PubChem CID | 6899727 |
| Molecular Formula | C34H33N5O3S |
| Molecular Weight | 591.74 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | (2E,5R,9E)-5-[4-(dimethylamino)phenyl]-9-[[4-(dimethylamino)phenyl]methylidene]-2-[(2-nitrophenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one |
| SMILES | CN(C)c1ccc(/C=C2\CCCC3=C2N=c2s/c(=C/c4ccccc4[N+](=O)[O-])c(=O)n2[C@@H]3c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H33N5O3S/c1-36(2)26-16-12-22(13-17-26)20-25-9-7-10-28-31(25)35-34-38(32(28)23-14-18-27(19-15-23)37(3)4)33(40)30(43-34)21-24-8-5-6-11-29(24)39(41)42/h5-6,8,11-21,32H,7,9-10H2,1-4H3/b25-20+,30-21+/t32-/m1/s1 |
| InChIKey | CXMPQWBMCKMPDJ-CJFQQIECSA-N |
| XLogP | 5.52 |
| TPSA | 83.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.74 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|