C32H27BrN2O3S — CID 129438094
(5R,9E)-2-[(4-bromophenyl)methylidene]-5-(4-methoxyphenyl)-9-[(4-methoxyphenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one (PubChem CID 129438094) has the molecular formula C32H27BrN2O3S and a molecular weight of 599.55 g/mol. Its IUPAC name is (5R,9E)-2-[(4-bromophenyl)methylidene]-5-(4-methoxyphenyl)-9-[(4-methoxyphenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one.
| Compound Name | (5R,9E)-2-[(4-bromophenyl)methylidene]-5-(4-methoxyphenyl)-9-[(4-methoxyphenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one |
|---|---|
| PubChem CID | 129438094 |
| Molecular Formula | C32H27BrN2O3S |
| Molecular Weight | 599.55 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | (5R,9E)-2-[(4-bromophenyl)methylidene]-5-(4-methoxyphenyl)-9-[(4-methoxyphenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one |
| SMILES | COc1ccc(/C=C2\CCCC3=C2N=c2sc(=Cc4ccc(Br)cc4)c(=O)n2[C@@H]3c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H27BrN2O3S/c1-37-25-14-8-20(9-15-25)18-23-4-3-5-27-29(23)34-32-35(30(27)22-10-16-26(38-2)17-11-22)31(36)28(39-32)19-21-6-12-24(33)13-7-21/h6-19,30H,3-5H2,1-2H3/b23-18+,28-19?/t30-/m1/s1 |
| InChIKey | DJMXUUHUTPFMMZ-HONULJLKSA-N |
| XLogP | 6.26 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.55 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |