C35H34F2N4O2S — CID 98389212
(2E,5R,9E)-2-[[4-(difluoromethoxy)phenyl]methylidene]-5-[4-(dimethylamino)phenyl]-9-[[4-(dimethylamino)phenyl]methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one (PubChem CID 98389212) has the molecular formula C35H34F2N4O2S and a molecular weight of 612.75 g/mol. Its IUPAC name is (2E,5R,9E)-2-[[4-(difluoromethoxy)phenyl]methylidene]-5-[4-(dimethylamino)phenyl]-9-[[4-(dimethylamino)phenyl]methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one.
| Compound Name | (2E,5R,9E)-2-[[4-(difluoromethoxy)phenyl]methylidene]-5-[4-(dimethylamino)phenyl]-9-[[4-(dimethylamino)phenyl]methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one |
|---|---|
| PubChem CID | 98389212 |
| Molecular Formula | C35H34F2N4O2S |
| Molecular Weight | 612.75 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | (2E,5R,9E)-2-[[4-(difluoromethoxy)phenyl]methylidene]-5-[4-(dimethylamino)phenyl]-9-[[4-(dimethylamino)phenyl]methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one |
| SMILES | CN(C)c1ccc(/C=C2\CCCC3=C2N=c2s/c(=C/c4ccc(OC(F)F)cc4)c(=O)n2[C@@H]3c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C35H34F2N4O2S/c1-39(2)26-14-8-22(9-15-26)20-25-6-5-7-29-31(25)38-35-41(32(29)24-12-16-27(17-13-24)40(3)4)33(42)30(44-35)21-23-10-18-28(19-11-23)43-34(36)37/h8-21,32,34H,5-7H2,1-4H3/b25-20+,30-21+/t32-/m1/s1 |
| InChIKey | NDUBOSVQUISYNW-CJFQQIECSA-N |
| XLogP | 6.22 |
| TPSA | 50.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.75 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|