C30H21Cl2N3O3S — CID 98420812
(2E,5S,9Z)-5-(4-chlorophenyl)-9-[(4-chlorophenyl)methylidene]-2-[(3-nitrophenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one (PubChem CID 98420812) has the molecular formula C30H21Cl2N3O3S and a molecular weight of 574.49 g/mol. Its IUPAC name is (2E,5S,9Z)-5-(4-chlorophenyl)-9-[(4-chlorophenyl)methylidene]-2-[(3-nitrophenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one.
| Compound Name | (2E,5S,9Z)-5-(4-chlorophenyl)-9-[(4-chlorophenyl)methylidene]-2-[(3-nitrophenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one |
|---|---|
| PubChem CID | 98420812 |
| Molecular Formula | C30H21Cl2N3O3S |
| Molecular Weight | 574.49 g/mol |
| Exact Mass | 573.07 |
| IUPAC Name | (2E,5S,9Z)-5-(4-chlorophenyl)-9-[(4-chlorophenyl)methylidene]-2-[(3-nitrophenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one |
| SMILES | O=c1/c(=C\c2cccc([N+](=O)[O-])c2)sc2n1[C@@H](c1ccc(Cl)cc1)C1=C(N=2)/C(=C\c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C30H21Cl2N3O3S/c31-22-11-7-18(8-12-22)15-21-4-2-6-25-27(21)33-30-34(28(25)20-9-13-23(32)14-10-20)29(36)26(39-30)17-19-3-1-5-24(16-19)35(37)38/h1,3,5,7-17,28H,2,4,6H2/b21-15-,26-17+/t28-/m0/s1 |
| InChIKey | ONWYJRIGTWYJEU-UZFOFPPESA-N |
| XLogP | 6.70 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.49 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|