C29H21Cl2N3O2S — CID 6512787
(9E)-5-(4-chlorophenyl)-9-[(4-chlorophenyl)methylidene]-3-(3-nitrophenyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline (PubChem CID 6512787) has the molecular formula C29H21Cl2N3O2S and a molecular weight of 546.48 g/mol. Its IUPAC name is (9E)-5-(4-chlorophenyl)-9-[(4-chlorophenyl)methylidene]-3-(3-nitrophenyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline.
| Compound Name | (9E)-5-(4-chlorophenyl)-9-[(4-chlorophenyl)methylidene]-3-(3-nitrophenyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline |
|---|---|
| PubChem CID | 6512787 |
| Molecular Formula | C29H21Cl2N3O2S |
| Molecular Weight | 546.48 g/mol |
| Exact Mass | 545.07 |
| IUPAC Name | (9E)-5-(4-chlorophenyl)-9-[(4-chlorophenyl)methylidene]-3-(3-nitrophenyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline |
| SMILES | O=[N+]([O-])c1cccc(C2=CSC3=NC4=C(CCC/C4=C\c4ccc(Cl)cc4)C(c4ccc(Cl)cc4)N23)c1 |
| InChI | InChI=1S/C29H21Cl2N3O2S/c30-22-11-7-18(8-12-22)15-21-4-2-6-25-27(21)32-29-33(28(25)19-9-13-23(31)14-10-19)26(17-37-29)20-3-1-5-24(16-20)34(35)36/h1,3,5,7-17,28H,2,4,6H2/b21-15+ |
| InChIKey | LOARZKMMQFPHFV-RCCKNPSSSA-N |
| XLogP | 8.88 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.48 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|