C27H25N3O6S — CID 23932254
2-[(3,4-dimethoxyphenyl)methylidene]-8,8-dimethyl-5-(4-nitrophenyl)-7,9-dihydro-5H-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione (PubChem CID 23932254) has the molecular formula C27H25N3O6S and a molecular weight of 519.58 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methylidene]-8,8-dimethyl-5-(4-nitrophenyl)-7,9-dihydro-5H-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methylidene]-8,8-dimethyl-5-(4-nitrophenyl)-7,9-dihydro-5H-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
|---|---|
| PubChem CID | 23932254 |
| Molecular Formula | C27H25N3O6S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methylidene]-8,8-dimethyl-5-(4-nitrophenyl)-7,9-dihydro-5H-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
| SMILES | COc1ccc(C=c2sc3n(c2=O)C(c2ccc([N+](=O)[O-])cc2)C2=C(CC(C)(C)CC2=O)N=3)cc1OC |
| InChI | InChI=1S/C27H25N3O6S/c1-27(2)13-18-23(19(31)14-27)24(16-6-8-17(9-7-16)30(33)34)29-25(32)22(37-26(29)28-18)12-15-5-10-20(35-3)21(11-15)36-4/h5-12,24H,13-14H2,1-4H3 |
| InChIKey | DMKLXKWADMAVBP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 113.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|