C28H27BrN2O5S — CID 23848037
5-(3-bromophenyl)-8,8-dimethyl-2-[(3,4,5-trimethoxyphenyl)methylidene]-7,9-dihydro-5H-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione (PubChem CID 23848037) has the molecular formula C28H27BrN2O5S and a molecular weight of 583.50 g/mol. Its IUPAC name is 5-(3-bromophenyl)-8,8-dimethyl-2-[(3,4,5-trimethoxyphenyl)methylidene]-7,9-dihydro-5H-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione.
| Compound Name | 5-(3-bromophenyl)-8,8-dimethyl-2-[(3,4,5-trimethoxyphenyl)methylidene]-7,9-dihydro-5H-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
|---|---|
| PubChem CID | 23848037 |
| Molecular Formula | C28H27BrN2O5S |
| Molecular Weight | 583.50 g/mol |
| Exact Mass | 582.08 |
| IUPAC Name | 5-(3-bromophenyl)-8,8-dimethyl-2-[(3,4,5-trimethoxyphenyl)methylidene]-7,9-dihydro-5H-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
| SMILES | COc1cc(C=c2sc3n(c2=O)C(c2cccc(Br)c2)C2=C(CC(C)(C)CC2=O)N=3)cc(OC)c1OC |
| InChI | InChI=1S/C28H27BrN2O5S/c1-28(2)13-18-23(19(32)14-28)24(16-7-6-8-17(29)12-16)31-26(33)22(37-27(31)30-18)11-15-9-20(34-3)25(36-5)21(10-15)35-4/h6-12,24H,13-14H2,1-5H3 |
| InChIKey | BLXVFHSGABCVJP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |