C25H20ClN3O4S — CID 23847607
2-[(2-chlorophenyl)methylidene]-8,8-dimethyl-5-(2-nitrophenyl)-7,9-dihydro-5H-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione (PubChem CID 23847607) has the molecular formula C25H20ClN3O4S and a molecular weight of 493.97 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylidene]-8,8-dimethyl-5-(2-nitrophenyl)-7,9-dihydro-5H-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione.
| Compound Name | 2-[(2-chlorophenyl)methylidene]-8,8-dimethyl-5-(2-nitrophenyl)-7,9-dihydro-5H-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
|---|---|
| PubChem CID | 23847607 |
| Molecular Formula | C25H20ClN3O4S |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 2-[(2-chlorophenyl)methylidene]-8,8-dimethyl-5-(2-nitrophenyl)-7,9-dihydro-5H-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N=c1sc(=Cc3ccccc3Cl)c(=O)n1C2c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H20ClN3O4S/c1-25(2)12-17-21(19(30)13-25)22(15-8-4-6-10-18(15)29(32)33)28-23(31)20(34-24(28)27-17)11-14-7-3-5-9-16(14)26/h3-11,22H,12-13H2,1-2H3 |
| InChIKey | FBDMBJLMXGBSLY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 94.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|