C8H11N5O2S — CID 155292871
4,6-dimethyl-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-ene-5,12-dione (PubChem CID 155292871) has the molecular formula C8H11N5O2S and a molecular weight of 241.28 g/mol. Its IUPAC name is 4,6-dimethyl-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-ene-5,12-dione.
| Compound Name | 4,6-dimethyl-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-ene-5,12-dione |
|---|---|
| PubChem CID | 155292871 |
| Molecular Formula | C8H11N5O2S |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 4,6-dimethyl-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-ene-5,12-dione |
| SMILES | CN1C(=O)N(C)C2NN3C(=O)CSC3=NC21 |
| InChI | InChI=1S/C8H11N5O2S/c1-11-5-6(12(2)8(11)15)10-13-4(14)3-16-7(13)9-5/h5-6,10H,3H2,1-2H3 |
| InChIKey | ILBOPDIXPDWYEG-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |