C16H17N5O2S — CID 73200559
1,3-dimethyl-6-phenyl-4a,8,9,11a-tetrahydropurino[8,7-b][1,3,5]thiadiazepine-2,4-dione (PubChem CID 73200559) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is 1,3-dimethyl-6-phenyl-4a,8,9,11a-tetrahydropurino[8,7-b][1,3,5]thiadiazepine-2,4-dione.
| Compound Name | 1,3-dimethyl-6-phenyl-4a,8,9,11a-tetrahydropurino[8,7-b][1,3,5]thiadiazepine-2,4-dione |
|---|---|
| PubChem CID | 73200559 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1,3-dimethyl-6-phenyl-4a,8,9,11a-tetrahydropurino[8,7-b][1,3,5]thiadiazepine-2,4-dione |
| SMILES | CN1C(=O)C2C(N=C3SCCN=C(c4ccccc4)N32)N(C)C1=O |
| InChI | InChI=1S/C16H17N5O2S/c1-19-13-11(14(22)20(2)16(19)23)21-12(10-6-4-3-5-7-10)17-8-9-24-15(21)18-13/h3-7,11,13H,8-9H2,1-2H3 |
| InChIKey | OTYMLUKDAIYQNI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 68.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |