C8H11BrN4O2 — CID 95732849
(4S,5R)-8-bromo-1,3,7-trimethyl-4,5-dihydropurine-2,6-dione (PubChem CID 95732849) has the molecular formula C8H11BrN4O2 and a molecular weight of 275.11 g/mol. Its IUPAC name is (4S,5R)-8-bromo-1,3,7-trimethyl-4,5-dihydropurine-2,6-dione.
| Compound Name | (4S,5R)-8-bromo-1,3,7-trimethyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 95732849 |
| Molecular Formula | C8H11BrN4O2 |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | (4S,5R)-8-bromo-1,3,7-trimethyl-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)[C@H]2[C@H](N=C(Br)N2C)N(C)C1=O |
| InChI | InChI=1S/C8H11BrN4O2/c1-11-4-5(10-7(11)9)12(2)8(15)13(3)6(4)14/h4-5H,1-3H3/t4-,5-/m1/s1 |
| InChIKey | ZOWTYYHHGAZZPJ-RFZPGFLSSA-N |
| XLogP | -0.10 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|