C20H18BrClN4O2 — CID 78212821
1-benzyl-8-bromo-7-[(4-chlorophenyl)methyl]-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 78212821) has the molecular formula C20H18BrClN4O2 and a molecular weight of 461.75 g/mol. Its IUPAC name is 1-benzyl-8-bromo-7-[(4-chlorophenyl)methyl]-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 1-benzyl-8-bromo-7-[(4-chlorophenyl)methyl]-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78212821 |
| Molecular Formula | C20H18BrClN4O2 |
| Molecular Weight | 461.75 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | 1-benzyl-8-bromo-7-[(4-chlorophenyl)methyl]-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)N(Cc2ccccc2)C(=O)C2C1N=C(Br)N2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18BrClN4O2/c1-24-17-16(18(27)26(20(24)28)12-13-5-3-2-4-6-13)25(19(21)23-17)11-14-7-9-15(22)10-8-14/h2-10,16-17H,11-12H2,1H3 |
| InChIKey | MXCIRYKXDDDUKD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|