C14H15ClN4O2 — CID 78170191
7-benzyl-8-chloro-1,3-dimethyl-4,5-dihydropurine-2,6-dione (PubChem CID 78170191) has the molecular formula C14H15ClN4O2 and a molecular weight of 306.75 g/mol. Its IUPAC name is 7-benzyl-8-chloro-1,3-dimethyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 7-benzyl-8-chloro-1,3-dimethyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78170191 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 7-benzyl-8-chloro-1,3-dimethyl-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)C2C(N=C(Cl)N2Cc2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C14H15ClN4O2/c1-17-11-10(12(20)18(2)14(17)21)19(13(15)16-11)8-9-6-4-3-5-7-9/h3-7,10-11H,8H2,1-2H3 |
| InChIKey | BBNBXDXIVVBJAJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|