C14H16N4O2 — CID 86308020
(4R,5R)-8-benzyl-1,3-dimethyl-5,7-dihydro-4H-purine-2,6-dione (PubChem CID 86308020) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is (4R,5R)-8-benzyl-1,3-dimethyl-5,7-dihydro-4H-purine-2,6-dione.
| Compound Name | (4R,5R)-8-benzyl-1,3-dimethyl-5,7-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 86308020 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (4R,5R)-8-benzyl-1,3-dimethyl-5,7-dihydro-4H-purine-2,6-dione |
| SMILES | CN1C(=O)[C@@H]2NC(Cc3ccccc3)=N[C@@H]2N(C)C1=O |
| InChI | InChI=1S/C14H16N4O2/c1-17-12-11(13(19)18(2)14(17)20)15-10(16-12)8-9-6-4-3-5-7-9/h3-7,11-12H,8H2,1-2H3,(H,15,16)/t11-,12-/m1/s1 |
| InChIKey | QOZZUTNLSJJWNT-VXGBXAGGSA-N |
| XLogP | 0.45 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |