C15H18N2O3 — CID 12954845
1,3-dimethyl-5-(3-phenylpropyl)-1,3-diazinane-2,4,6-trione (PubChem CID 12954845) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1,3-dimethyl-5-(3-phenylpropyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-(3-phenylpropyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 12954845 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1,3-dimethyl-5-(3-phenylpropyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(CCCc2ccccc2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C15H18N2O3/c1-16-13(18)12(14(19)17(2)15(16)20)10-6-9-11-7-4-3-5-8-11/h3-5,7-8,12H,6,9-10H2,1-2H3 |
| InChIKey | HIROIJBNKWEVNE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|