C15H20N2O — CID 55167339
4-ethyl-5-methyl-2-(3-phenylpropyl)-4H-pyrazol-3-one (PubChem CID 55167339) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-ethyl-5-methyl-2-(3-phenylpropyl)-4H-pyrazol-3-one.
| Compound Name | 4-ethyl-5-methyl-2-(3-phenylpropyl)-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 55167339 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 4-ethyl-5-methyl-2-(3-phenylpropyl)-4H-pyrazol-3-one |
| SMILES | CCC1C(=O)N(CCCc2ccccc2)N=C1C |
| InChI | InChI=1S/C15H20N2O/c1-3-14-12(2)16-17(15(14)18)11-7-10-13-8-5-4-6-9-13/h4-6,8-9,14H,3,7,10-11H2,1-2H3 |
| InChIKey | QGLCUFWDUONHIU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |