C13H19N3 — CID 83232450
4-methyl-2-(3-phenylpropyl)-3,4-dihydropyrazol-5-amine (PubChem CID 83232450) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 4-methyl-2-(3-phenylpropyl)-3,4-dihydropyrazol-5-amine.
| Compound Name | 4-methyl-2-(3-phenylpropyl)-3,4-dihydropyrazol-5-amine |
|---|---|
| PubChem CID | 83232450 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 4-methyl-2-(3-phenylpropyl)-3,4-dihydropyrazol-5-amine |
| SMILES | CC1CN(CCCc2ccccc2)N=C1N |
| InChI | InChI=1S/C13H19N3/c1-11-10-16(15-13(11)14)9-5-8-12-6-3-2-4-7-12/h2-4,6-7,11H,5,8-10H2,1H3,(H2,14,15) |
| InChIKey | WCNMQLCXCDNIMR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |