C13H19N3 — CID 15916618
2-(4-phenylbutyl)-3,4-dihydropyrazol-5-amine (PubChem CID 15916618) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 2-(4-phenylbutyl)-3,4-dihydropyrazol-5-amine.
| Compound Name | 2-(4-phenylbutyl)-3,4-dihydropyrazol-5-amine |
|---|---|
| PubChem CID | 15916618 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 2-(4-phenylbutyl)-3,4-dihydropyrazol-5-amine |
| SMILES | NC1=NN(CCCCc2ccccc2)CC1 |
| InChI | InChI=1S/C13H19N3/c14-13-9-11-16(15-13)10-5-4-8-12-6-2-1-3-7-12/h1-3,6-7H,4-5,8-11H2,(H2,14,15) |
| InChIKey | GNHVKSYHPIMLDC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|