C10H13N5 — CID 175917505
4-(2-phenylethyl)-1,2,4-triazole-3,5-diamine (PubChem CID 175917505) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 4-(2-phenylethyl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 4-(2-phenylethyl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 175917505 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 4-(2-phenylethyl)-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nnc(N)n1CCc1ccccc1 |
| InChI | InChI=1S/C10H13N5/c11-9-13-14-10(12)15(9)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,11,13)(H2,12,14) |
| InChIKey | IIBZESSJWJUALK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |