C11H14N4S — CID 30935241
5-(azaniumylmethyl)-4-(2-phenylethyl)-1,2,4-triazole-3-thiolate (PubChem CID 30935241) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 5-(azaniumylmethyl)-4-(2-phenylethyl)-1,2,4-triazole-3-thiolate.
| Compound Name | 5-(azaniumylmethyl)-4-(2-phenylethyl)-1,2,4-triazole-3-thiolate |
|---|---|
| PubChem CID | 30935241 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5-(azaniumylmethyl)-4-(2-phenylethyl)-1,2,4-triazole-3-thiolate |
| SMILES | [NH3+]Cc1nnc([S-])n1CCc1ccccc1 |
| InChI | InChI=1S/C11H14N4S/c12-8-10-13-14-11(16)15(10)7-6-9-4-2-1-3-5-9/h1-5H,6-8,12H2,(H,14,16) |
| InChIKey | PCQBEKWVDSFYSD-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|