C18H19N3 — CID 141167257
3,4-bis(2-phenylethyl)-1,2,4-triazole (PubChem CID 141167257) has the molecular formula C18H19N3 and a molecular weight of 277.37 g/mol. Its IUPAC name is 3,4-bis(2-phenylethyl)-1,2,4-triazole.
| Compound Name | 3,4-bis(2-phenylethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 141167257 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 3,4-bis(2-phenylethyl)-1,2,4-triazole |
| SMILES | c1ccc(CCc2nncn2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H19N3/c1-3-7-16(8-4-1)11-12-18-20-19-15-21(18)14-13-17-9-5-2-6-10-17/h1-10,15H,11-14H2 |
| InChIKey | VFMQUNBXYKCCCK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |