C19H18N4 — CID 141167256
3-[[4-(2-phenylethyl)-1,2,4-triazol-3-yl]methyl]-1H-indole (PubChem CID 141167256) has the molecular formula C19H18N4 and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-[[4-(2-phenylethyl)-1,2,4-triazol-3-yl]methyl]-1H-indole.
| Compound Name | 3-[[4-(2-phenylethyl)-1,2,4-triazol-3-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 141167256 |
| Molecular Formula | C19H18N4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3-[[4-(2-phenylethyl)-1,2,4-triazol-3-yl]methyl]-1H-indole |
| SMILES | c1ccc(CCn2cnnc2Cc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C19H18N4/c1-2-6-15(7-3-1)10-11-23-14-21-22-19(23)12-16-13-20-18-9-5-4-8-17(16)18/h1-9,13-14,20H,10-12H2 |
| InChIKey | MWGPGYFRGCJFBT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |