C14H17N5 — CID 104911671
(1R)-1-(4-ethyl-1,2,4-triazol-3-yl)-2-(1H-indol-3-yl)ethanamine (PubChem CID 104911671) has the molecular formula C14H17N5 and a molecular weight of 255.32 g/mol. Its IUPAC name is (1R)-1-(4-ethyl-1,2,4-triazol-3-yl)-2-(1H-indol-3-yl)ethanamine.
| Compound Name | (1R)-1-(4-ethyl-1,2,4-triazol-3-yl)-2-(1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 104911671 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | (1R)-1-(4-ethyl-1,2,4-triazol-3-yl)-2-(1H-indol-3-yl)ethanamine |
| SMILES | CCn1cnnc1[C@H](N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H17N5/c1-2-19-9-17-18-14(19)12(15)7-10-8-16-13-6-4-3-5-11(10)13/h3-6,8-9,12,16H,2,7,15H2,1H3/t12-/m1/s1 |
| InChIKey | LFKRPPIISMNCOP-GFCCVEGCSA-N |
| XLogP | 2.02 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |