C11H14N4 — CID 94552562
(S)-(4-ethyl-1,2,4-triazol-3-yl)-phenylmethanamine (PubChem CID 94552562) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is (S)-(4-ethyl-1,2,4-triazol-3-yl)-phenylmethanamine.
| Compound Name | (S)-(4-ethyl-1,2,4-triazol-3-yl)-phenylmethanamine |
|---|---|
| PubChem CID | 94552562 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (S)-(4-ethyl-1,2,4-triazol-3-yl)-phenylmethanamine |
| SMILES | CCn1cnnc1[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C11H14N4/c1-2-15-8-13-14-11(15)10(12)9-6-4-3-5-7-9/h3-8,10H,2,12H2,1H3/t10-/m0/s1 |
| InChIKey | PGKKXMORKXVNHQ-JTQLQIEISA-N |
| XLogP | 1.35 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |