C9H17N3 — CID 115394788
4-ethyl-3-pentan-2-yl-1,2,4-triazole (PubChem CID 115394788) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 4-ethyl-3-pentan-2-yl-1,2,4-triazole.
| Compound Name | 4-ethyl-3-pentan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 115394788 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 4-ethyl-3-pentan-2-yl-1,2,4-triazole |
| SMILES | CCCC(C)c1nncn1CC |
| InChI | InChI=1S/C9H17N3/c1-4-6-8(3)9-11-10-7-12(9)5-2/h7-8H,4-6H2,1-3H3 |
| InChIKey | DASWKNVLUHOXMM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |