About 4-(4-ethyl-1,2,4-triazol-3-yl)-2-methylbutan-1-amine
4-(4-ethyl-1,2,4-triazol-3-yl)-2-methylbutan-1-amine (PubChem CID 82014118) has the molecular formula C9H18N4
and a molecular weight of 182.27 g/mol. Its IUPAC name is 4-(4-ethyl-1,2,4-triazol-3-yl)-2-methylbutan-1-amine.
Analyze 4-(4-ethyl-1,2,4-triazol-3-yl)-2-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-ethyl-1,2,4-triazol-3-yl)-2-methylbutan-1-amine?
The IUPAC name of 4-(4-ethyl-1,2,4-triazol-3-yl)-2-methylbutan-1-amine (CID 82014118) is 4-(4-ethyl-1,2,4-triazol-3-yl)-2-methylbutan-1-amine.
What is the SMILES notation for 4-(4-ethyl-1,2,4-triazol-3-yl)-2-methylbutan-1-amine?
The canonical SMILES for 4-(4-ethyl-1,2,4-triazol-3-yl)-2-methylbutan-1-amine is CCn1cnnc1CCC(C)CN.
What is the InChIKey of 4-(4-ethyl-1,2,4-triazol-3-yl)-2-methylbutan-1-amine?
The InChIKey is LJKOUEQXYLWSMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4/c1-3-13-7-11-12-9(13)5-4-8(2)6-10/h7-8H,3-6,10H2,1-2H3.
What are the key properties of 4-(4-ethyl-1,2,4-triazol-3-yl)-2-methylbutan-1-amine?
4-(4-ethyl-1,2,4-triazol-3-yl)-2-methylbutan-1-amine has a molecular weight of 182.27 g/mol, XLogP of 0.83, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethyl-1,2,4-triazol-3-yl)-2-methylbutan-1-amine is sourced from PubChem (CID 82014118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).