About [4-(3-methylbutyl)-1,2,4-triazol-3-yl]methanamine
[4-(3-methylbutyl)-1,2,4-triazol-3-yl]methanamine (PubChem CID 82468055) has the molecular formula C8H16N4
and a molecular weight of 168.24 g/mol. Its IUPAC name is [4-(3-methylbutyl)-1,2,4-triazol-3-yl]methanamine.
Analyze [4-(3-methylbutyl)-1,2,4-triazol-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-methylbutyl)-1,2,4-triazol-3-yl]methanamine?
The IUPAC name of [4-(3-methylbutyl)-1,2,4-triazol-3-yl]methanamine (CID 82468055) is [4-(3-methylbutyl)-1,2,4-triazol-3-yl]methanamine.
What is the SMILES notation for [4-(3-methylbutyl)-1,2,4-triazol-3-yl]methanamine?
The canonical SMILES for [4-(3-methylbutyl)-1,2,4-triazol-3-yl]methanamine is CC(C)CCn1cnnc1CN.
What is the InChIKey of [4-(3-methylbutyl)-1,2,4-triazol-3-yl]methanamine?
The InChIKey is AULFKLQQXAZSHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4/c1-7(2)3-4-12-6-10-11-8(12)5-9/h6-7H,3-5,9H2,1-2H3.
What are the key properties of [4-(3-methylbutyl)-1,2,4-triazol-3-yl]methanamine?
[4-(3-methylbutyl)-1,2,4-triazol-3-yl]methanamine has a molecular weight of 168.24 g/mol, XLogP of 0.78, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-methylbutyl)-1,2,4-triazol-3-yl]methanamine is sourced from PubChem (CID 82468055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).