C17H15Cl2N3 — CID 141167255
4-[(3,4-dichlorophenyl)methyl]-3-(2-phenylethyl)-1,2,4-triazole (PubChem CID 141167255) has the molecular formula C17H15Cl2N3 and a molecular weight of 332.23 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl]-3-(2-phenylethyl)-1,2,4-triazole.
| Compound Name | 4-[(3,4-dichlorophenyl)methyl]-3-(2-phenylethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 141167255 |
| Molecular Formula | C17H15Cl2N3 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl]-3-(2-phenylethyl)-1,2,4-triazole |
| SMILES | Clc1ccc(Cn2cnnc2CCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C17H15Cl2N3/c18-15-8-6-14(10-16(15)19)11-22-12-20-21-17(22)9-7-13-4-2-1-3-5-13/h1-6,8,10,12H,7,9,11H2 |
| InChIKey | GZYVVRDSKKUAMY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |