C17H17N3O — CID 141167246
3-benzyl-4-[(4-methoxyphenyl)methyl]-1,2,4-triazole (PubChem CID 141167246) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-benzyl-4-[(4-methoxyphenyl)methyl]-1,2,4-triazole.
| Compound Name | 3-benzyl-4-[(4-methoxyphenyl)methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 141167246 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 3-benzyl-4-[(4-methoxyphenyl)methyl]-1,2,4-triazole |
| SMILES | COc1ccc(Cn2cnnc2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H17N3O/c1-21-16-9-7-15(8-10-16)12-20-13-18-19-17(20)11-14-5-3-2-4-6-14/h2-10,13H,11-12H2,1H3 |
| InChIKey | CTDZRJPYKMRSPG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |