C14H17N3O2S — CID 176706419
S-[2-[4-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]ethyl] ethanethioate (PubChem CID 176706419) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is S-[2-[4-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]ethyl] ethanethioate.
| Compound Name | S-[2-[4-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]ethyl] ethanethioate |
|---|---|
| PubChem CID | 176706419 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | S-[2-[4-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]ethyl] ethanethioate |
| SMILES | COc1ccc(Cn2cnnc2CCSC(C)=O)cc1 |
| InChI | InChI=1S/C14H17N3O2S/c1-11(18)20-8-7-14-16-15-10-17(14)9-12-3-5-13(19-2)6-4-12/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | HXDJXTJZJHERQT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|