C17H15F2N3O — CID 165389898
5-benzyl-3-(difluoromethyl)-1-(4-methoxyphenyl)-1,2,4-triazole (PubChem CID 165389898) has the molecular formula C17H15F2N3O and a molecular weight of 315.32 g/mol. Its IUPAC name is 5-benzyl-3-(difluoromethyl)-1-(4-methoxyphenyl)-1,2,4-triazole.
| Compound Name | 5-benzyl-3-(difluoromethyl)-1-(4-methoxyphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 165389898 |
| Molecular Formula | C17H15F2N3O |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 5-benzyl-3-(difluoromethyl)-1-(4-methoxyphenyl)-1,2,4-triazole |
| SMILES | COc1ccc(-n2nc(C(F)F)nc2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H15F2N3O/c1-23-14-9-7-13(8-10-14)22-15(20-17(21-22)16(18)19)11-12-5-3-2-4-6-12/h2-10,16H,11H2,1H3 |
| InChIKey | AGBXHCAIUCBGPN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |