C19H19N5O2 — CID 91767891
N'-phenyl-N-[[4-(2-phenylethyl)-1,2,4-triazol-3-yl]methyl]oxamide (PubChem CID 91767891) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is N'-phenyl-N-[[4-(2-phenylethyl)-1,2,4-triazol-3-yl]methyl]oxamide.
| Compound Name | N'-phenyl-N-[[4-(2-phenylethyl)-1,2,4-triazol-3-yl]methyl]oxamide |
|---|---|
| PubChem CID | 91767891 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N'-phenyl-N-[[4-(2-phenylethyl)-1,2,4-triazol-3-yl]methyl]oxamide |
| SMILES | O=C(NCc1nncn1CCc1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H19N5O2/c25-18(19(26)22-16-9-5-2-6-10-16)20-13-17-23-21-14-24(17)12-11-15-7-3-1-4-8-15/h1-10,14H,11-13H2,(H,20,25)(H,22,26) |
| InChIKey | VIAYHHLZKFQGTB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|