About dioxido(oxo)phosphanium;bis(2-phenylethylazanium)
dioxido(oxo)phosphanium;bis(2-phenylethylazanium) (PubChem CID 160857650) has the molecular formula C16H24N2O3P+
and a molecular weight of 323.35 g/mol. Its IUPAC name is dioxido(oxo)phosphanium;bis(2-phenylethylazanium).
Molecular Properties
| Compound Name | dioxido(oxo)phosphanium;bis(2-phenylethylazanium) |
| PubChem CID | 160857650 |
| Molecular Formula | C16H24N2O3P+ |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | dioxido(oxo)phosphanium;bis(2-phenylethylazanium) |
| SMILES | O=[P+]([O-])[O-].[NH3+]CCc1ccccc1.[NH3+]CCc1ccccc1 |
| InChI | InChI=1S/2C8H11N.HO3P/c2*9-7-6-8-4-2-1-3-5-8;1-4(2)3/h2*1-5H,6-7,9H2;(H,1,2,3)/p+1 |
| InChIKey | LVKXPZIRTSXCMT-UHFFFAOYSA-O |
| XLogP | -0.69 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dioxido(oxo)phosphanium;bis(2-phenylethylazanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(oxo)phosphanium;bis(2-phenylethylazanium)?
The IUPAC name of dioxido(oxo)phosphanium;bis(2-phenylethylazanium) (CID 160857650) is dioxido(oxo)phosphanium;bis(2-phenylethylazanium).
What is the SMILES notation for dioxido(oxo)phosphanium;bis(2-phenylethylazanium)?
The canonical SMILES for dioxido(oxo)phosphanium;bis(2-phenylethylazanium) is O=[P+]([O-])[O-].[NH3+]CCc1ccccc1.[NH3+]CCc1ccccc1.
What is the InChIKey of dioxido(oxo)phosphanium;bis(2-phenylethylazanium)?
The InChIKey is LVKXPZIRTSXCMT-UHFFFAOYSA-O. The full InChI is InChI=1S/2C8H11N.HO3P/c2*9-7-6-8-4-2-1-3-5-8;1-4(2)3/h2*1-5H,6-7,9H2;(H,1,2,3)/p+1.
What are the key properties of dioxido(oxo)phosphanium;bis(2-phenylethylazanium)?
dioxido(oxo)phosphanium;bis(2-phenylethylazanium) has a molecular weight of 323.35 g/mol, XLogP of -0.69, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(oxo)phosphanium;bis(2-phenylethylazanium) is sourced from PubChem (CID 160857650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).