C12H14ClN3 — CID 63384637
3-chloro-5-ethyl-4-(2-phenylethyl)-1,2,4-triazole (PubChem CID 63384637) has the molecular formula C12H14ClN3 and a molecular weight of 235.72 g/mol. Its IUPAC name is 3-chloro-5-ethyl-4-(2-phenylethyl)-1,2,4-triazole.
| Compound Name | 3-chloro-5-ethyl-4-(2-phenylethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 63384637 |
| Molecular Formula | C12H14ClN3 |
| Molecular Weight | 235.72 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 3-chloro-5-ethyl-4-(2-phenylethyl)-1,2,4-triazole |
| SMILES | CCc1nnc(Cl)n1CCc1ccccc1 |
| InChI | InChI=1S/C12H14ClN3/c1-2-11-14-15-12(13)16(11)9-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| InChIKey | QJXPVKHVMUJBKL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.72 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |