C13H17N3S — CID 28563943
3-benzylsulfanyl-4,5-diethyl-1,2,4-triazole (PubChem CID 28563943) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is 3-benzylsulfanyl-4,5-diethyl-1,2,4-triazole.
| Compound Name | 3-benzylsulfanyl-4,5-diethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 28563943 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 3-benzylsulfanyl-4,5-diethyl-1,2,4-triazole |
| SMILES | CCc1nnc(SCc2ccccc2)n1CC |
| InChI | InChI=1S/C13H17N3S/c1-3-12-14-15-13(16(12)4-2)17-10-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | RVMKKWSZNSZTGX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |