C14H19N3S — CID 8708190
3-benzylsulfanyl-4-ethyl-5-propyl-1,2,4-triazole (PubChem CID 8708190) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 3-benzylsulfanyl-4-ethyl-5-propyl-1,2,4-triazole.
| Compound Name | 3-benzylsulfanyl-4-ethyl-5-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 8708190 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3-benzylsulfanyl-4-ethyl-5-propyl-1,2,4-triazole |
| SMILES | CCCc1nnc(SCc2ccccc2)n1CC |
| InChI | InChI=1S/C14H19N3S/c1-3-8-13-15-16-14(17(13)4-2)18-11-12-9-6-5-7-10-12/h5-7,9-10H,3-4,8,11H2,1-2H3 |
| InChIKey | BEXXLMGXSCSMCH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |