C18H19N3S — CID 126096377
3-benzylsulfanyl-5-phenyl-4-propyl-1,2,4-triazole (PubChem CID 126096377) has the molecular formula C18H19N3S and a molecular weight of 309.44 g/mol. Its IUPAC name is 3-benzylsulfanyl-5-phenyl-4-propyl-1,2,4-triazole.
| Compound Name | 3-benzylsulfanyl-5-phenyl-4-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 126096377 |
| Molecular Formula | C18H19N3S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-benzylsulfanyl-5-phenyl-4-propyl-1,2,4-triazole |
| SMILES | CCCn1c(SCc2ccccc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C18H19N3S/c1-2-13-21-17(16-11-7-4-8-12-16)19-20-18(21)22-14-15-9-5-3-6-10-15/h3-12H,2,13-14H2,1H3 |
| InChIKey | PVDAUTJMLFBGBQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |