C15H18N3O2S- — CID 8708347
3-[(4-ethyl-5-propyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzoate (PubChem CID 8708347) has the molecular formula C15H18N3O2S- and a molecular weight of 304.40 g/mol. Its IUPAC name is 3-[(4-ethyl-5-propyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzoate.
| Compound Name | 3-[(4-ethyl-5-propyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 8708347 |
| Molecular Formula | C15H18N3O2S- |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3-[(4-ethyl-5-propyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzoate |
| SMILES | CCCc1nnc(SCc2cccc(C(=O)[O-])c2)n1CC |
| InChI | InChI=1S/C15H19N3O2S/c1-3-6-13-16-17-15(18(13)4-2)21-10-11-7-5-8-12(9-11)14(19)20/h5,7-9H,3-4,6,10H2,1-2H3,(H,19,20)/p-1 |
| InChIKey | KVKCYNAGKOLRTQ-UHFFFAOYSA-M |
| XLogP | 1.91 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |