C22H26N4O2S — CID 10364253
methyl 3-[[4-[(4-aminophenyl)methyl]-5-butyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate (PubChem CID 10364253) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is methyl 3-[[4-[(4-aminophenyl)methyl]-5-butyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate.
| Compound Name | methyl 3-[[4-[(4-aminophenyl)methyl]-5-butyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 10364253 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | methyl 3-[[4-[(4-aminophenyl)methyl]-5-butyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate |
| SMILES | CCCCc1nnc(SCc2cccc(C(=O)OC)c2)n1Cc1ccc(N)cc1 |
| InChI | InChI=1S/C22H26N4O2S/c1-3-4-8-20-24-25-22(26(20)14-16-9-11-19(23)12-10-16)29-15-17-6-5-7-18(13-17)21(27)28-2/h5-7,9-13H,3-4,8,14-15,23H2,1-2H3 |
| InChIKey | PNLQYNVAOAEDFV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|