C21H24N4O3S — CID 10409437
3-butyl-5-[(3-methoxyphenyl)methylsulfanyl]-4-[(4-nitrophenyl)methyl]-1,2,4-triazole (PubChem CID 10409437) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 3-butyl-5-[(3-methoxyphenyl)methylsulfanyl]-4-[(4-nitrophenyl)methyl]-1,2,4-triazole.
| Compound Name | 3-butyl-5-[(3-methoxyphenyl)methylsulfanyl]-4-[(4-nitrophenyl)methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 10409437 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 3-butyl-5-[(3-methoxyphenyl)methylsulfanyl]-4-[(4-nitrophenyl)methyl]-1,2,4-triazole |
| SMILES | CCCCc1nnc(SCc2cccc(OC)c2)n1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H24N4O3S/c1-3-4-8-20-22-23-21(29-15-17-6-5-7-19(13-17)28-2)24(20)14-16-9-11-18(12-10-16)25(26)27/h5-7,9-13H,3-4,8,14-15H2,1-2H3 |
| InChIKey | ITEZTLWHDLGPDU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|