C21H21F3N4O2S — CID 10366493
3-butyl-4-[(4-nitrophenyl)methyl]-5-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazole (PubChem CID 10366493) has the molecular formula C21H21F3N4O2S and a molecular weight of 450.49 g/mol. Its IUPAC name is 3-butyl-4-[(4-nitrophenyl)methyl]-5-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazole.
| Compound Name | 3-butyl-4-[(4-nitrophenyl)methyl]-5-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 10366493 |
| Molecular Formula | C21H21F3N4O2S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 3-butyl-4-[(4-nitrophenyl)methyl]-5-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazole |
| SMILES | CCCCc1nnc(SCc2ccc(C(F)(F)F)cc2)n1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H21F3N4O2S/c1-2-3-4-19-25-26-20(27(19)13-15-7-11-18(12-8-15)28(29)30)31-14-16-5-9-17(10-6-16)21(22,23)24/h5-12H,2-4,13-14H2,1H3 |
| InChIKey | NAVWTWODTXZNBW-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|