C16H17F3N4 — CID 171647436
5-amino-2-butyl-1-[[4-(trifluoromethyl)phenyl]methyl]imidazole-4-carbonitrile (PubChem CID 171647436) has the molecular formula C16H17F3N4 and a molecular weight of 322.33 g/mol. Its IUPAC name is 5-amino-2-butyl-1-[[4-(trifluoromethyl)phenyl]methyl]imidazole-4-carbonitrile.
| Compound Name | 5-amino-2-butyl-1-[[4-(trifluoromethyl)phenyl]methyl]imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 171647436 |
| Molecular Formula | C16H17F3N4 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 5-amino-2-butyl-1-[[4-(trifluoromethyl)phenyl]methyl]imidazole-4-carbonitrile |
| SMILES | CCCCc1nc(C#N)c(N)n1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H17F3N4/c1-2-3-4-14-22-13(9-20)15(21)23(14)10-11-5-7-12(8-6-11)16(17,18)19/h5-8H,2-4,10,21H2,1H3 |
| InChIKey | ZGHPAHMUKBBKGI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |