C15H23N3SSi — CID 56570814
(5-benzyl-4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl-trimethylsilane (PubChem CID 56570814) has the molecular formula C15H23N3SSi and a molecular weight of 305.52 g/mol. Its IUPAC name is (5-benzyl-4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl-trimethylsilane.
| Compound Name | (5-benzyl-4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl-trimethylsilane |
|---|---|
| PubChem CID | 56570814 |
| Molecular Formula | C15H23N3SSi |
| Molecular Weight | 305.52 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (5-benzyl-4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl-trimethylsilane |
| SMILES | CCn1c(Cc2ccccc2)nnc1SC[Si](C)(C)C |
| InChI | InChI=1S/C15H23N3SSi/c1-5-18-14(11-13-9-7-6-8-10-13)16-17-15(18)19-12-20(2,3)4/h6-10H,5,11-12H2,1-4H3 |
| InChIKey | BTABIXQMVMGZMX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|