C15H21N3S — CID 126108779
3-benzyl-4-propyl-5-propylsulfanyl-1,2,4-triazole (PubChem CID 126108779) has the molecular formula C15H21N3S and a molecular weight of 275.42 g/mol. Its IUPAC name is 3-benzyl-4-propyl-5-propylsulfanyl-1,2,4-triazole.
| Compound Name | 3-benzyl-4-propyl-5-propylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 126108779 |
| Molecular Formula | C15H21N3S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 3-benzyl-4-propyl-5-propylsulfanyl-1,2,4-triazole |
| SMILES | CCCSc1nnc(Cc2ccccc2)n1CCC |
| InChI | InChI=1S/C15H21N3S/c1-3-10-18-14(12-13-8-6-5-7-9-13)16-17-15(18)19-11-4-2/h5-9H,3-4,10-12H2,1-2H3 |
| InChIKey | SWFLIEVSRLDCHZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |