C14H20N4S2 — CID 79222517
[5-(2-phenylsulfanylethylsulfanyl)-4-propyl-1,2,4-triazol-3-yl]methanamine (PubChem CID 79222517) has the molecular formula C14H20N4S2 and a molecular weight of 308.48 g/mol. Its IUPAC name is [5-(2-phenylsulfanylethylsulfanyl)-4-propyl-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [5-(2-phenylsulfanylethylsulfanyl)-4-propyl-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 79222517 |
| Molecular Formula | C14H20N4S2 |
| Molecular Weight | 308.48 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | [5-(2-phenylsulfanylethylsulfanyl)-4-propyl-1,2,4-triazol-3-yl]methanamine |
| SMILES | CCCn1c(CN)nnc1SCCSc1ccccc1 |
| InChI | InChI=1S/C14H20N4S2/c1-2-8-18-13(11-15)16-17-14(18)20-10-9-19-12-6-4-3-5-7-12/h3-7H,2,8-11,15H2,1H3 |
| InChIKey | UDBCRVRMEFJRMU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|