C13H18N4OS — CID 63314085
[4-ethyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]methanamine (PubChem CID 63314085) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is [4-ethyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [4-ethyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 63314085 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | [4-ethyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]methanamine |
| SMILES | CCn1c(CN)nnc1SCCOc1ccccc1 |
| InChI | InChI=1S/C13H18N4OS/c1-2-17-12(10-14)15-16-13(17)19-9-8-18-11-6-4-3-5-7-11/h3-7H,2,8-10,14H2,1H3 |
| InChIKey | WECNOFLBVYTGEX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|